Difference between revisions of "CPD-8610"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
(Created page with "Category:metabolite == Metabolite CPD-578 == * common-name: ** urea-1-carboxylate * smiles: ** c(n)(nc([o-])=o)=o * inchi-key: ** avwrkzwqtyikiy-uhfffaoysa-m * molecular-w...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-578 == |
* common-name: | * common-name: | ||
− | ** | + | ** urea-1-carboxylate |
* smiles: | * smiles: | ||
− | ** | + | ** c(n)(nc([o-])=o)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** avwrkzwqtyikiy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 103.057 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ALLOPHANATE-HYDROLASE-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=urea-1-carboxylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=avwrkzwqtyikiy-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.057}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD-578
- common-name:
- urea-1-carboxylate
- smiles:
- c(n)(nc([o-])=o)=o
- inchi-key:
- avwrkzwqtyikiy-uhfffaoysa-m
- molecular-weight:
- 103.057