Difference between revisions of "CPD-8610"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cis-delta-3-decenoyl-ACPs == * common-name: ** a (3z)-dec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN0-2141 =...") |
(Created page with "Category:metabolite == Metabolite CPD-13375 == * common-name: ** xxxg xyloglucan oligosaccharide * smiles: ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13375 == |
* common-name: | * common-name: | ||
| − | ** | + | ** xxxg xyloglucan oligosaccharide |
| + | * smiles: | ||
| + | ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o) | ||
| + | * inchi-key: | ||
| + | ** pzupagrihcrvkn-sphbqonksa-n | ||
| + | * molecular-weight: | ||
| + | ** 1062.931 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12398]] | ||
| + | * [[RXN-12399]] | ||
| + | * [[RXN-12400]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=xxxg xyloglucan oligosaccharide}} |
| + | {{#set: inchi-key=inchikey=pzupagrihcrvkn-sphbqonksa-n}} | ||
| + | {{#set: molecular-weight=1062.931}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite CPD-13375
- common-name:
- xxxg xyloglucan oligosaccharide
- smiles:
- c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
- inchi-key:
- pzupagrihcrvkn-sphbqonksa-n
- molecular-weight:
- 1062.931
