Difference between revisions of "CPD-8614"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...") |
(Created page with "Category:metabolite == Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his == * common-name: ** a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his == |
* common-name: | * common-name: | ||
− | ** | + | ** a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11373]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-11374]] | |
− | * [[RXN- | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2]}} |
− | |||
− |
Revision as of 14:54, 5 January 2021
Contents
Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his
- common-name:
- a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.