Difference between revisions of "CPD-8614"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01521 == * transcription-direction: ** negative * right-end-position: ** 13050 * left-end-position: ** 12027 * centisome-position: ** 8.012498...") |
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PSEUDOURIDINE-5-P == |
| − | * | + | * common-name: |
| − | ** | + | ** pseudouridine 5'-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** mobmojgxnhllir-gbndhiklsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 322.168 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-15703]] |
| − | == Reaction(s) | + | * [[RXN0-5398]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[PSEUDOURIDINE-KINASE-RXN]] |
| − | + | * [[RXN-15703]] | |
| − | + | * [[RXN0-5398]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=pseudouridine 5'-phosphate}} | |
| − | * [[ | + | {{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}} |
| − | + | {{#set: molecular-weight=322.168}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite PSEUDOURIDINE-5-P
- common-name:
- pseudouridine 5'-phosphate
- smiles:
- c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
- inchi-key:
- mobmojgxnhllir-gbndhiklsa-l
- molecular-weight:
- 322.168
