Difference between revisions of "CPD-8619"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL == * common-name: ** 2-carboxy-d-arabinitol * smiles: ** c(c(c(c(c([o-])=o)(co)o)o)o)o * inchi-key: ** xondrgralzt...") |
(Created page with "Category:metabolite == Metabolite CPD-8619 == * common-name: ** 4α-carboxy-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)(...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8619 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4α-carboxy-5α-cholesta-8-en-3β-ol |
* smiles: | * smiles: | ||
| − | ** c(c(c(c(c([o-])=o)( | + | ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c([o-])=o)c(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rodbxvvnkjcwqr-gsqagghasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 429.662 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-23]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4α-carboxy-5α-cholesta-8-en-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rodbxvvnkjcwqr-gsqagghasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=429.662}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-8619
- common-name:
- 4α-carboxy-5α-cholesta-8-en-3β-ol
- smiles:
- cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c([o-])=o)c(o)cc3)))cc4)))c
- inchi-key:
- rodbxvvnkjcwqr-gsqagghasa-m
- molecular-weight:
- 429.662
