Difference between revisions of "CPD-8620"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite CPD-8620 == * common-name: ** 5α-cholesta-8-en-3-one * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(=o)cc3)))c...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SOLANESYL-PYROPHOSPHATE ==
+
== Metabolite CPD-8620 ==
 
* common-name:
 
* common-name:
** all-trans-nonaprenyl diphosphate
+
** 5α-cholesta-8-en-3-one
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(=o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** ivlbhbftrnviap-meggaxogsa-k
+
** rzsxshnnqbiptl-zsbatxslsa-n
 
* molecular-weight:
 
* molecular-weight:
** 788.015
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2761]]
+
* [[RXN66-24]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11486]]
+
* [[RXN66-23]]
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-nonaprenyl diphosphate}}
+
{{#set: common-name=5α-cholesta-8-en-3-one}}
{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
+
{{#set: inchi-key=inchikey=rzsxshnnqbiptl-zsbatxslsa-n}}
{{#set: molecular-weight=788.015}}
+
{{#set: molecular-weight=384.644}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8620

  • common-name:
    • 5α-cholesta-8-en-3-one
  • smiles:
    • cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(=o)cc3)))cc4)))c
  • inchi-key:
    • rzsxshnnqbiptl-zsbatxslsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality