Difference between revisions of "CPD-8620"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite 2-hydroxyacyl-glutathiones == * common-name: ** s-(2-hydroxyacyl)glutathione == Reaction(s) known to consume the compound == * RXN-7919...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SOLANESYL-PYROPHOSPHATE ==
+
== Metabolite 2-hydroxyacyl-glutathiones ==
 
* common-name:
 
* common-name:
** all-trans-nonaprenyl diphosphate
+
** s-(2-hydroxyacyl)glutathione
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
* inchi-key:
 
** ivlbhbftrnviap-meggaxogsa-k
 
* molecular-weight:
 
** 788.015
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2761]]
+
* [[RXN-7919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11486]]
 
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-nonaprenyl diphosphate}}
+
{{#set: common-name=s-(2-hydroxyacyl)glutathione}}
{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
 
{{#set: molecular-weight=788.015}}
 

Revision as of 18:53, 14 January 2021

Metabolite 2-hydroxyacyl-glutathiones

  • common-name:
    • s-(2-hydroxyacyl)glutathione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality