Difference between revisions of "CPD-8624"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12505 == * transcription-direction: ** negative * right-end-position: ** 740002 * left-end-position: ** 736101 * centisome-position: ** 98.2149...")
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12505 ==
+
== Metabolite CPD-786 ==
* transcription-direction:
+
* common-name:
** negative
+
** (4z)-2-oxohept-4-enedioate
* right-end-position:
+
* smiles:
** 740002
+
** c(ccc=cc(c([o-])=o)=o)([o-])=o
* left-end-position:
+
* inchi-key:
** 736101
+
** hyvszvzmtyihkf-iwqzzhsrsa-l
* centisome-position:
+
* molecular-weight:
** 98.2149   
+
** 170.121
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN1K-87]]
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(4z)-2-oxohept-4-enedioate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hyvszvzmtyihkf-iwqzzhsrsa-l}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=170.121}}
{{#set: right-end-position=740002}}
 
{{#set: left-end-position=736101}}
 
{{#set: centisome-position=98.2149    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-786

  • common-name:
    • (4z)-2-oxohept-4-enedioate
  • smiles:
    • c(ccc=cc(c([o-])=o)=o)([o-])=o
  • inchi-key:
    • hyvszvzmtyihkf-iwqzzhsrsa-l
  • molecular-weight:
    • 170.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality