Difference between revisions of "CPD-8624"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...")
(Created page with "Category:metabolite == Metabolite CPD-19217 == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-786 ==
+
== Metabolite CPD-19217 ==
 
* common-name:
 
* common-name:
** (4z)-2-oxohept-4-enedioate
+
** s-(hydroxysulfenamide)-glutathione
 
* smiles:
 
* smiles:
** c(ccc=cc(c([o-])=o)=o)([o-])=o
+
** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** hyvszvzmtyihkf-iwqzzhsrsa-l
+
** zoiidzwlsvvtgq-wdskdsinsa-m
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 337.327
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1K-87]]
+
* [[RXN-17884]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4z)-2-oxohept-4-enedioate}}
+
{{#set: common-name=s-(hydroxysulfenamide)-glutathione}}
{{#set: inchi-key=inchikey=hyvszvzmtyihkf-iwqzzhsrsa-l}}
+
{{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=337.327}}

Revision as of 14:53, 5 January 2021

Metabolite CPD-19217

  • common-name:
    • s-(hydroxysulfenamide)-glutathione
  • smiles:
    • c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • zoiidzwlsvvtgq-wdskdsinsa-m
  • molecular-weight:
    • 337.327

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality