Difference between revisions of "CPD-8624"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19217 == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-...") |
(Created page with "Category:metabolite == Metabolite ACYL-ACP == * common-name: ** an acyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1-ACYLGLYCEROL-3-P-ACYLT...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACYL-ACP == |
* common-name: | * common-name: | ||
− | ** | + | ** an acyl-[acyl-carrier protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]] | ||
+ | * [[1.3.1.9-RXN]] | ||
+ | * [[2.3.1.41-RXN]] | ||
+ | * [[RXN-10462]] | ||
+ | * [[RXN-16067]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.3.1.9-RXN]] |
+ | * [[2.3.1.41-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an acyl-[acyl-carrier protein]}} |
− | |||
− |
Revision as of 15:24, 5 January 2021
Contents
Metabolite ACYL-ACP
- common-name:
- an acyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an acyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.