Difference between revisions of "CPD-8630"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18319 == * common-name: ** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate * smiles: ** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-8630 == * common-name: ** a 5'-diphospho-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-GUANYLYLTRANSFERASE-R...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18319 ==
+
== Metabolite CPD-8630 ==
 
* common-name:
 
* common-name:
** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
+
** a 5'-diphospho-purine-[mrna]
* smiles:
 
** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
 
* inchi-key:
 
** lqrxqgmibgpnby-pzgqecojsa-n
 
* molecular-weight:
 
** 217.181
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16991]]
+
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[RXN-12826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 +
* [[RXN-12826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate}}
+
{{#set: common-name=a 5'-diphospho-purine-[mrna]}}
{{#set: inchi-key=inchikey=lqrxqgmibgpnby-pzgqecojsa-n}}
 
{{#set: molecular-weight=217.181}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-8630

  • common-name:
    • a 5'-diphospho-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-diphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.