Difference between revisions of "CPD-8630"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-8630 == * common-name: ** a 5'-diphospho-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-GUANYLYLTRANSFERASE-R...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8630 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5'-diphospho-purine-[mrna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[MRNA-GUANYLYLTRANSFERASE-RXN]] |
+ | * [[RXN-12826]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]] | ||
+ | * [[RXN-12826]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5'-diphospho-purine-[mrna]}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-8630
- common-name:
- a 5'-diphospho-purine-[mrna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-diphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.