Difference between revisions of "CPD-8653"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-560 == * common-name: ** s-methyl-5-thio-d-ribose * smiles: ** cscc1(oc(c(c1o)o)o) * inchi-key: ** olvvoviftbsbbh-jdjsbbgdsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-1823 == * common-name: ** nπ-methyl-l-histidine * smiles: ** cn1(c=nc=c1cc(c(=o)[o-])[n+]) * inchi-key: ** jdhildinmrgule-lurjtmie...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-1823 == |
* common-name: | * common-name: | ||
| − | ** | + | ** nπ-methyl-l-histidine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn1(c=nc=c1cc(c(=o)[o-])[n+]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jdhildinmrgule-lurjtmiesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 169.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[X-METHYL-HIS-DIPEPTIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nπ-methyl-l-histidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jdhildinmrgule-lurjtmiesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=169.183}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-1823
- common-name:
- nπ-methyl-l-histidine
- smiles:
- cn1(c=nc=c1cc(c(=o)[o-])[n+])
- inchi-key:
- jdhildinmrgule-lurjtmiesa-n
- molecular-weight:
- 169.183
