Difference between revisions of "CPD-8653"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1823 == * common-name: ** nπ-methyl-l-histidine * smiles: ** cn1(c=nc=c1cc(c(=o)[o-])[n+]) * inchi-key: ** jdhildinmrgule-lurjtmie...") |
(Created page with "Category:metabolite == Metabolite CPD-14719 == * common-name: ** heptadecanal * smiles: ** cccccccccccccccc[ch]=o * inchi-key: ** piydvaykybwppy-uhfffaoysa-n * molecular-w...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14719 == |
* common-name: | * common-name: | ||
| − | ** | + | ** heptadecanal |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** piydvaykybwppy-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 254.455 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=heptadecanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=piydvaykybwppy-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=254.455}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-14719
- common-name:
- heptadecanal
- smiles:
- cccccccccccccccc[ch]=o
- inchi-key:
- piydvaykybwppy-uhfffaoysa-n
- molecular-weight:
- 254.455
