Difference between revisions of "CPD-8653"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19310 == * transcription-direction: ** negative * right-end-position: ** 190464 * left-end-position: ** 180889 * centisome-position: ** 79.16714...") |
(Created page with "Category:metabolite == Metabolite CPD-8653 == * common-name: ** betanidin * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) * in...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8653 == |
− | * | + | * common-name: |
− | ** | + | ** betanidin |
− | * | + | * smiles: |
− | ** | + | ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) |
− | + | * inchi-key: | |
− | + | ** xhjkhsxhwjcblx-aaeuagobsa-l | |
− | + | * molecular-weight: | |
− | + | ** 386.317 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-8635]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=betanidin}} | |
− | * | + | {{#set: inchi-key=inchikey=xhjkhsxhwjcblx-aaeuagobsa-l}} |
− | ** | + | {{#set: molecular-weight=386.317}} |
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8653
- common-name:
- betanidin
- smiles:
- c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
- inchi-key:
- xhjkhsxhwjcblx-aaeuagobsa-l
- molecular-weight:
- 386.317