Difference between revisions of "CPD-8653"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19310 == * transcription-direction: ** negative * right-end-position: ** 190464 * left-end-position: ** 180889 * centisome-position: ** 79.16714...")
(Created page with "Category:metabolite == Metabolite CPD-8653 == * common-name: ** betanidin * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) * in...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19310 ==
+
== Metabolite CPD-8653 ==
* transcription-direction:
+
* common-name:
** negative
+
** betanidin
* right-end-position:
+
* smiles:
** 190464
+
** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
* left-end-position:
+
* inchi-key:
** 180889
+
** xhjkhsxhwjcblx-aaeuagobsa-l
* centisome-position:
+
* molecular-weight:
** 79.16714   
+
** 386.317
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8635]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTOHEMEFERROCHELAT-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=betanidin}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xhjkhsxhwjcblx-aaeuagobsa-l}}
** Category: [[orthology]]
+
{{#set: molecular-weight=386.317}}
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-17518]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY0-1415]]
 
** '''5''' reactions found over '''4''' reactions in the full pathway
 
* [[HEMESYN2-PWY]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[HEME-BIOSYNTHESIS-II]]
 
** '''4''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7766]]
 
** '''3''' reactions found over '''5''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=190464}}
 
{{#set: left-end-position=180889}}
 
{{#set: centisome-position=79.16714    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8653

  • common-name:
    • betanidin
  • smiles:
    • c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
  • inchi-key:
    • xhjkhsxhwjcblx-aaeuagobsa-l
  • molecular-weight:
    • 386.317

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality