Difference between revisions of "CPD-8653"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OHyW-tRNAPhe == * common-name: ** 2-hydroxy-wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite CPD-8653 == * common-name: ** betanidin * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) * in...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8653 == |
* common-name: | * common-name: | ||
− | ** | + | ** betanidin |
+ | * smiles: | ||
+ | ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) | ||
+ | * inchi-key: | ||
+ | ** xhjkhsxhwjcblx-aaeuagobsa-l | ||
+ | * molecular-weight: | ||
+ | ** 386.317 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8635]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=betanidin}} |
+ | {{#set: inchi-key=inchikey=xhjkhsxhwjcblx-aaeuagobsa-l}} | ||
+ | {{#set: molecular-weight=386.317}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8653
- common-name:
- betanidin
- smiles:
- c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
- inchi-key:
- xhjkhsxhwjcblx-aaeuagobsa-l
- molecular-weight:
- 386.317