Difference between revisions of "CPD-8653"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite OHyW-tRNAPhe == * common-name: ** 2-hydroxy-wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OHyW-tRNAPhe == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-hydroxy-wybutosine37 in trnaphe |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-14540]] | |
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-wybutosine37 in trnaphe}} |
− | |||
− |
Revision as of 15:25, 5 January 2021
Contents
Metabolite OHyW-tRNAPhe
- common-name:
- 2-hydroxy-wybutosine37 in trnaphe