Difference between revisions of "CPD-8678"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RH-Group == * common-name: ** an organic molecule == Reaction(s) known to consume the compound == * RXN-12615 * UNSPECIFIC-MONOOXYG...") |
(Created page with "Category:metabolite == Metabolite CPD-8678 == * common-name: ** 9(s)-hpote * smiles: ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo * inchi-key: ** rwkjtihnysiihw-mebvtjqtsa-m * mol...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8678 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9(s)-hpote |
| + | * smiles: | ||
| + | ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo | ||
| + | * inchi-key: | ||
| + | ** rwkjtihnysiihw-mebvtjqtsa-m | ||
| + | * molecular-weight: | ||
| + | ** 309.425 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8497]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9(s)-hpote}} |
| + | {{#set: inchi-key=inchikey=rwkjtihnysiihw-mebvtjqtsa-m}} | ||
| + | {{#set: molecular-weight=309.425}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8678
- common-name:
- 9(s)-hpote
- smiles:
- ccc=ccc=cc=cc(cccccccc([o-])=o)oo
- inchi-key:
- rwkjtihnysiihw-mebvtjqtsa-m
- molecular-weight:
- 309.425
