Difference between revisions of "CPD-8775"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58. RXN-11820-STEARIC_ACID/HYDR...") |
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8775 == |
| − | * | + | * common-name: |
| − | ** | + | ** m-toluate |
| − | == | + | * smiles: |
| − | * | + | ** cc1(=cc(=cc=c1)c(=o)[o-]) |
| − | == | + | * inchi-key: |
| − | == | + | ** gpsduzxpycfosq-uhfffaoysa-m |
| − | + | * molecular-weight: | |
| − | * | + | ** 135.142 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-8583]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=m-toluate}} |
| − | + | {{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}} | |
| − | + | {{#set: molecular-weight=135.142}} | |
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-8775
- common-name:
- m-toluate
- smiles:
- cc1(=cc(=cc=c1)c(=o)[o-])
- inchi-key:
- gpsduzxpycfosq-uhfffaoysa-m
- molecular-weight:
- 135.142
