Difference between revisions of "CPD-8775"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8775 == |
* common-name: | * common-name: | ||
− | ** | + | ** m-toluate |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=cc(=cc=c1)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gpsduzxpycfosq-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 135.142 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8583]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=m-toluate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=135.142}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-8775
- common-name:
- m-toluate
- smiles:
- cc1(=cc(=cc=c1)c(=o)[o-])
- inchi-key:
- gpsduzxpycfosq-uhfffaoysa-m
- molecular-weight:
- 135.142