Difference between revisions of "CPD-8775"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15689 ==
+
== Metabolite CPD-8775 ==
 
* common-name:
 
* common-name:
** (2e,5e)-dodeca-2,5-dienoyl-coa
+
** m-toluate
 
* smiles:
 
* smiles:
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(=cc(=cc=c1)c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** zsjrxhrcabosnc-uovvplbnsa-j
+
** gpsduzxpycfosq-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 941.776
+
** 135.142
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14801]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8583]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5e)-dodeca-2,5-dienoyl-coa}}
+
{{#set: common-name=m-toluate}}
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-uovvplbnsa-j}}
+
{{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}}
{{#set: molecular-weight=941.776}}
+
{{#set: molecular-weight=135.142}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-8775

  • common-name:
    • m-toluate
  • smiles:
    • cc1(=cc(=cc=c1)c(=o)[o-])
  • inchi-key:
    • gpsduzxpycfosq-uhfffaoysa-m
  • molecular-weight:
    • 135.142

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality