Difference between revisions of "CPD-8815"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * smiles: ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite Pro-tRNA-Cytidine4 == * common-name: ** a cytidine4 in trnapro == Reaction(s) known to consume the compound == * RXN-12477 == Reactio...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Pro-tRNA-Cytidine4 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cytidine4 in trnapro |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12477]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cytidine4 in trnapro}} |
| − | |||
| − | |||
Revision as of 08:24, 15 March 2021
Contents
Metabolite Pro-tRNA-Cytidine4
- common-name:
- a cytidine4 in trnapro
