Difference between revisions of "CPD-8815"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18537 == * transcription-direction: ** positive * right-end-position: ** 60155 * left-end-position: ** 58945 * centisome-position: ** 24.288286...")
(Created page with "Category:metabolite == Metabolite CPD-8815 == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o-])=o)o) * inchi-key: ** njesaxzanhetjv-uhfffaoysa-m...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18537 ==
+
== Metabolite CPD-8815 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 2,4-dihydroxybenzoate
−
* right-end-position:
+
* smiles:
−
** 60155
+
** cc1(=cc(=c(c=c1)c([o-])=o)o)
−
* left-end-position:
+
* inchi-key:
−
** 58945
+
** njesaxzanhetjv-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 24.288286   
+
** 151.141
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10078]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[3.6.3.1-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2,4-dihydroxybenzoate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}}
−
* [[ATPASE-RXN]]
+
{{#set: molecular-weight=151.141}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=60155}}
 
−
{{#set: left-end-position=58945}}
 
−
{{#set: centisome-position=24.288286    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8815

  • common-name:
    • 2,4-dihydroxybenzoate
  • smiles:
    • cc1(=cc(=c(c=c1)c([o-])=o)o)
  • inchi-key:
    • njesaxzanhetjv-uhfffaoysa-m
  • molecular-weight:
    • 151.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8815&oldid=136741"