Difference between revisions of "CPD-8815"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18537 == * transcription-direction: ** positive * right-end-position: ** 60155 * left-end-position: ** 58945 * centisome-position: ** 24.288286...") |
(Created page with "Category:metabolite == Metabolite CPD-8815 == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o-])=o)o) * inchi-key: ** njesaxzanhetjv-uhfffaoysa-m...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8815 == |
− | * | + | * common-name: |
− | ** | + | ** 2,4-dihydroxybenzoate |
− | * | + | * smiles: |
− | ** | + | ** cc1(=cc(=c(c=c1)c([o-])=o)o) |
− | * | + | * inchi-key: |
− | ** | + | ** njesaxzanhetjv-uhfffaoysa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 151.141 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10078]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=2,4-dihydroxybenzoate}} | |
− | + | {{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}} | |
− | + | {{#set: molecular-weight=151.141}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8815
- common-name:
- 2,4-dihydroxybenzoate
- smiles:
- cc1(=cc(=c(c=c1)c([o-])=o)o)
- inchi-key:
- njesaxzanhetjv-uhfffaoysa-m
- molecular-weight:
- 151.141