Difference between revisions of "CPD-8815"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...") |
(Created page with "Category:metabolite == Metabolite CPD-8815 == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o-])=o)o) * inchi-key: ** njesaxzanhetjv-uhfffaoysa-m...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8815 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,4-dihydroxybenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=cc(=c(c=c1)c([o-])=o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** njesaxzanhetjv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 151.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10078]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,4-dihydroxybenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=151.141}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8815
- common-name:
- 2,4-dihydroxybenzoate
- smiles:
- cc1(=cc(=c(c=c1)c([o-])=o)o)
- inchi-key:
- njesaxzanhetjv-uhfffaoysa-m
- molecular-weight:
- 151.141
