Difference between revisions of "CPD-8815"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Secondary-Alcohols == * common-name: ** a secondary alcohol == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-...")
(Created page with "Category:metabolite == Metabolite CPD-8815 == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o-])=o)o) * inchi-key: ** njesaxzanhetjv-uhfffaoysa-m...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Secondary-Alcohols ==
+
== Metabolite CPD-8815 ==
 
* common-name:
 
* common-name:
** a secondary alcohol
+
** 2,4-dihydroxybenzoate
 +
* smiles:
 +
** cc1(=cc(=c(c=c1)c([o-])=o)o)
 +
* inchi-key:
 +
** njesaxzanhetjv-uhfffaoysa-m
 +
* molecular-weight:
 +
** 151.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
+
* [[RXN-10078]]
* [[RXN-12448]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 
* [[RXN-12448]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a secondary alcohol}}
+
{{#set: common-name=2,4-dihydroxybenzoate}}
 +
{{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}}
 +
{{#set: molecular-weight=151.141}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8815

  • common-name:
    • 2,4-dihydroxybenzoate
  • smiles:
    • cc1(=cc(=c(c=c1)c([o-])=o)o)
  • inchi-key:
    • njesaxzanhetjv-uhfffaoysa-m
  • molecular-weight:
    • 151.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality