Difference between revisions of "CPD-8815"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-3-HYDROXYACYL-COA == * common-name: ** a (3s)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == * OHACYL-COA-DEHYDROG...") |
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14154 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tobramycin |
| + | * smiles: | ||
| + | ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o) | ||
| + | * inchi-key: | ||
| + | ** nlvfbuxfdbbnbw-pbsuhmdjsa-s | ||
| + | * molecular-weight: | ||
| + | ** 472.558 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13168]] |
| − | * [[RXN- | + | * [[RXN-15284]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tobramycin}} |
| + | {{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}} | ||
| + | {{#set: molecular-weight=472.558}} | ||
Revision as of 15:24, 5 January 2021
Contents
Metabolite CPD-14154
- common-name:
- tobramycin
- smiles:
- c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
- inchi-key:
- nlvfbuxfdbbnbw-pbsuhmdjsa-s
- molecular-weight:
- 472.558
