Difference between revisions of "CPD-8815"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...")
(Created page with "Category:metabolite == Metabolite Secondary-Alcohols == * common-name: ** a secondary alcohol == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14154 ==
+
== Metabolite Secondary-Alcohols ==
 
* common-name:
 
* common-name:
** tobramycin
+
** a secondary alcohol
* smiles:
 
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
 
* inchi-key:
 
** nlvfbuxfdbbnbw-pbsuhmdjsa-s
 
* molecular-weight:
 
** 472.558
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13168]]
+
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
* [[RXN-15284]]
+
* [[RXN-12448]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 +
* [[RXN-12448]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tobramycin}}
+
{{#set: common-name=a secondary alcohol}}
{{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}}
 
{{#set: molecular-weight=472.558}}
 

Revision as of 18:52, 14 January 2021

Metabolite Secondary-Alcohols

  • common-name:
    • a secondary alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality