Difference between revisions of "CPD-8890"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2152 == * common-name: ** 1-18:0-2-lysophosphatidylethanolamine * smiles: ** cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...")
(Created page with "Category:metabolite == Metabolite CPD-11241 == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate * smiles: ** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2152 ==
+
== Metabolite CPD-11241 ==
 
* common-name:
 
* common-name:
** 1-18:0-2-lysophosphatidylethanolamine
+
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
 
* smiles:
 
* smiles:
** cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
+
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
 
* inchi-key:
 
* inchi-key:
** bbywoyafbuoufp-jochjyfzsa-n
+
** llvvmxfnkahvez-gawnparcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 481.608
+
** 350.235
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LPLPS1AGPE180h]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14897]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:0-2-lysophosphatidylethanolamine}}
+
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
{{#set: inchi-key=inchikey=bbywoyafbuoufp-jochjyfzsa-n}}
+
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
{{#set: molecular-weight=481.608}}
+
{{#set: molecular-weight=350.235}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-11241

  • common-name:
    • 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
  • smiles:
    • c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
  • inchi-key:
    • llvvmxfnkahvez-gawnparcsa-l
  • molecular-weight:
    • 350.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality