Difference between revisions of "CPD-8890"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol == Reaction(s) known to consume the compound == * RXN-17731...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-Alkyl-2-acyl-glycerol == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-acyl-1-alkyl-sn-glycerol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17731]] |
| + | * [[RXN-17733]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17730]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-acyl-1-alkyl-sn-glycerol}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite 1-Alkyl-2-acyl-glycerol
- common-name:
- a 2-acyl-1-alkyl-sn-glycerol
