Difference between revisions of "CPD-8892"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRISTANATE == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c * inchi-key: ** pahgjzdqxioyth-uhfffaoysa-m *...") |
(Created page with "Category:metabolite == Metabolite CPD-8892 == * common-name: ** leukotriene a4 * smiles: ** cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-]) * inchi-key: ** ufpqiryspuyqhk-xwyp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8892 == |
* common-name: | * common-name: | ||
| − | ** | + | ** leukotriene a4 |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufpqiryspuyqhk-xwypzhsrsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 317.447 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LEUKOTRIENE-A4-HYDROLASE-RXN]] |
| + | * [[LEUKOTRIENE-C4-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13395]] | ||
| + | * [[RXN-8647]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=leukotriene a4}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufpqiryspuyqhk-xwypzhsrsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=317.447}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-8892
- common-name:
- leukotriene a4
- smiles:
- cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-])
- inchi-key:
- ufpqiryspuyqhk-xwypzhsrsa-m
- molecular-weight:
- 317.447
