Difference between revisions of "CPD-8892"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite CPD-8892 == * common-name: ** leukotriene a4 * smiles: ** cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-]) * inchi-key: ** ufpqiryspuyqhk-xwyp...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2106 ==
+
== Metabolite CPD-8892 ==
 
* common-name:
 
* common-name:
** 3-oxooctanoyl-coa
+
** leukotriene a4
 
* smiles:
 
* smiles:
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** wpivbcgrgvnddt-cecatxlmsa-j
+
** ufpqiryspuyqhk-xwypzhsrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 903.684
+
** 317.447
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
* [[RXN-14277]]
+
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[RXN-13395]]
* [[RXN-14275]]
+
* [[RXN-8647]]
* [[RXN-14277]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxooctanoyl-coa}}
+
{{#set: common-name=leukotriene a4}}
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
+
{{#set: inchi-key=inchikey=ufpqiryspuyqhk-xwypzhsrsa-m}}
{{#set: molecular-weight=903.684}}
+
{{#set: molecular-weight=317.447}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8892

  • common-name:
    • leukotriene a4
  • smiles:
    • cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-])
  • inchi-key:
    • ufpqiryspuyqhk-xwypzhsrsa-m
  • molecular-weight:
    • 317.447

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality