Difference between revisions of "CPD-8892"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite Pyruvate-Dehydrogenase-Phosphoserine == * common-name: ** a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2106 ==
+
== Metabolite Pyruvate-Dehydrogenase-Phosphoserine ==
 
* common-name:
 
* common-name:
** 3-oxooctanoyl-coa
+
** a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate
* smiles:
 
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wpivbcgrgvnddt-cecatxlmsa-j
 
* molecular-weight:
 
** 903.684
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[3.1.3.43-RXN]]
* [[RXN-14277]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[2.7.11.2-RXN]]
* [[RXN-14275]]
 
* [[RXN-14277]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxooctanoyl-coa}}
+
{{#set: common-name=a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate}}
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
 
{{#set: molecular-weight=903.684}}
 

Revision as of 14:59, 5 January 2021

Metabolite Pyruvate-Dehydrogenase-Phosphoserine

  • common-name:
    • a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.