Difference between revisions of "CPD-8901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...")
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-GULONATE ==
+
== Metabolite DCMP ==
 
* common-name:
 
* common-name:
** l-gulonate
+
** dcmp
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** rghnjxzeokukbd-qtbdoelssa-m
+
** ncmvoabpesmrcp-shyzeuofsa-l
 
* molecular-weight:
 
* molecular-weight:
** 195.149
+
** 305.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ATDCM]]
 +
* [[DCMP-DEAMINASE-RXN]]
 +
* [[RXN-7913]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCURONATE-REDUCTASE-RXN]]
+
* [[DCTP-PYROPHOSPHATASE-RXN]]
* [[RXN-8783]]
+
* [[RXN-14187]]
 +
* [[RXN-14198]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-gulonate}}
+
{{#set: common-name=dcmp}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}}
+
{{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}}
{{#set: molecular-weight=195.149}}
+
{{#set: molecular-weight=305.183}}

Revision as of 08:28, 15 March 2021

Metabolite DCMP

  • common-name:
    • dcmp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
  • inchi-key:
    • ncmvoabpesmrcp-shyzeuofsa-l
  • molecular-weight:
    • 305.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality