Difference between revisions of "CPD-8901"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-8901 == * common-name: ** a [protein] n6-methyl-l-lysine == Reaction(s) known to consume the compound == * RXN-8661 == Reaction(s...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8901 == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein] n6-methyl-l-lysine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8661]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-8660]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein] n6-methyl-l-lysine}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-8901
- common-name:
- a [protein] n6-methyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein] n6-methyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.