Difference between revisions of "CPD-8901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17332 == * common-name: ** 3-oxo-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
(Created page with "Category:metabolite == Metabolite CPD-8901 == * common-name: ** a [protein] n6-methyl-l-lysine == Reaction(s) known to consume the compound == * RXN-8661 == Reaction(s...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17332 ==
+
== Metabolite CPD-8901 ==
 
* common-name:
 
* common-name:
** 3-oxo-tetracosapentaenoyl-coa
+
** a [protein] n6-methyl-l-lysine
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** uqpanogfyczrav-afqbpcmksa-j
 
* molecular-weight:
 
** 1118.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16129]]
+
* [[RXN-8661]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8660]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-tetracosapentaenoyl-coa}}
+
{{#set: common-name=a [protein] n6-methyl-l-lysine}}
{{#set: inchi-key=inchikey=uqpanogfyczrav-afqbpcmksa-j}}
 
{{#set: molecular-weight=1118.034}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-8901

  • common-name:
    • a [protein] n6-methyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] n6-methyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.