Difference between revisions of "CPD-8901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKBLIG-RXN AKBLIG-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/E...")
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKBLIG-RXN AKBLIG-RXN] ==
+
== Metabolite TREHALOSE-6P ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** α,α-trehalose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.29 ec-2.3.1.29]
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[AMINO-OXOBUT]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[GLY]][c]
+
** labspybhmpdtel-lizsdcnhsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ01689]]
+
** 420.263
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[TREHALOSEPHOSPHA-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[THREONINE-DEG2-PWY]], L-threonine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-DEG2-PWY THREONINE-DEG2-PWY]
+
* [[TREHALOSE6PSYN-RXN]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[UG6PGT]]
−
== Reconstruction information  ==
+
* [[UG6PGTn]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=α,α-trehalose 6-phosphate}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00371 R00371]
+
{{#set: molecular-weight=420.263}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00370 R00370]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20736 20736]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q9RRY6 Q9RRY6]
 
−
** [http://www.uniprot.org/uniprot/O58030 O58030]
 
−
** [http://www.uniprot.org/uniprot/Q9UY32 Q9UY32]
 
−
** [http://www.uniprot.org/uniprot/O31777 O31777]
 
−
** [http://www.uniprot.org/uniprot/Q22768 Q22768]
 
−
** [http://www.uniprot.org/uniprot/P0AB77 P0AB77]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.3.1.29}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:34, 18 December 2020

Metabolite TREHALOSE-6P

  • common-name:
    • α,α-trehalose 6-phosphate
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
  • inchi-key:
    • labspybhmpdtel-lizsdcnhsa-l
  • molecular-weight:
    • 420.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8901&oldid=47365"