Difference between revisions of "CPD-8973"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-adenine1518-adenine1519 == * common-name: ** adenine1518/adenine1519 in 16s rrna == Reaction(s) known to consume the compound ==...")
(Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi-key: ** fpwmcupfbrfmlh-xgaoum...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 16S-rRNA-adenine1518-adenine1519 ==
+
== Metabolite PREPHENATE ==
 
* common-name:
 
* common-name:
** adenine1518/adenine1519 in 16s rrna
+
** prephenate
 +
* smiles:
 +
** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
 +
* inchi-key:
 +
** fpwmcupfbrfmlh-xgaoumnusa-l
 +
* molecular-weight:
 +
** 224.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11633]]
+
* [[CHORISMATEMUT-RXN]]
 +
* [[PPDH]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[PREPHENATEDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CHORISMATEMUT-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenine1518/adenine1519 in 16s rrna}}
+
{{#set: common-name=prephenate}}
 +
{{#set: inchi-key=inchikey=fpwmcupfbrfmlh-xgaoumnusa-l}}
 +
{{#set: molecular-weight=224.17}}

Revision as of 08:24, 15 March 2021

Metabolite PREPHENATE

  • common-name:
    • prephenate
  • smiles:
    • c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
  • inchi-key:
    • fpwmcupfbrfmlh-xgaoumnusa-l
  • molecular-weight:
    • 224.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality