Difference between revisions of "CPD-8973"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-adenine1518-adenine1519 == * common-name: ** adenine1518/adenine1519 in 16s rrna == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-8973 == * common-name: ** methyl parathion * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s * inchi-key: ** rlbiqvvomopohc-uhfffa...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8973 == |
* common-name: | * common-name: | ||
| − | ** | + | ** methyl parathion |
| + | * smiles: | ||
| + | ** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s | ||
| + | * inchi-key: | ||
| + | ** rlbiqvvomopohc-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 263.204 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8743]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methyl parathion}} |
| + | {{#set: inchi-key=inchikey=rlbiqvvomopohc-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=263.204}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8973
- common-name:
- methyl parathion
- smiles:
- cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
- inchi-key:
- rlbiqvvomopohc-uhfffaoysa-n
- molecular-weight:
- 263.204
