Difference between revisions of "CPD-8973"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13780 == * transcription-direction: ** positive * right-end-position: ** 180905 * left-end-position: ** 169935 * centisome-position: ** 51.33275...")
 
(Created page with "Category:metabolite == Metabolite CPD-8973 == * common-name: ** methyl parathion * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s * inchi-key: ** rlbiqvvomopohc-uhfffa...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13780 ==
+
== Metabolite CPD-8973 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** methyl parathion
−
* right-end-position:
+
* smiles:
−
** 180905
+
** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
−
* left-end-position:
+
* inchi-key:
−
** 169935
+
** rlbiqvvomopohc-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 51.33275   
+
** 263.204
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8743]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ATPASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=methyl parathion}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=rlbiqvvomopohc-uhfffaoysa-n}}
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=263.204}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=180905}}
 
−
{{#set: left-end-position=169935}}
 
−
{{#set: centisome-position=51.33275    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8973

  • common-name:
    • methyl parathion
  • smiles:
    • cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
  • inchi-key:
    • rlbiqvvomopohc-uhfffaoysa-n
  • molecular-weight:
    • 263.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8973&oldid=136791"