Difference between revisions of "CPD-8973"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14725 == * transcription-direction: ** positive * right-end-position: ** 131332 * left-end-position: ** 130400 * centisome-position: ** 41.996643...")
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14725 ==
+
== Metabolite 5-DEHYDROGLUCONATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 5-dehydro-d-gluconate
−
* right-end-position:
+
* smiles:
−
** 131332
+
** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 130400
+
** izsrjdgcgrauar-mrozadkfsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 41.996643   
+
** 193.133
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-12107]]
−
* [[1.1.1.197-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-dehydro-d-gluconate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=izsrjdgcgrauar-mrozadkfsa-m}}
−
* [[1.1.1.270-RXN]]
+
{{#set: molecular-weight=193.133}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13686]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-19]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-24]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-314]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-319]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[RIBITOLUTIL-PWY]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY66-3]]
 
−
** '''12''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY66-4]]
 
−
** '''14''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6074]]
 
−
** '''6''' reactions found over '''14''' reactions in the full pathway
 
−
* [[PWY66-341]]
 
−
** '''14''' reactions found over '''18''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=131332}}
 
−
{{#set: left-end-position=130400}}
 
−
{{#set: centisome-position=41.996643    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=10}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 20:30, 18 December 2020

Metabolite 5-DEHYDROGLUCONATE

  • common-name:
    • 5-dehydro-d-gluconate
  • smiles:
    • c(o)c(=o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • izsrjdgcgrauar-mrozadkfsa-m
  • molecular-weight:
    • 193.133

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8973&oldid=45607"