Difference between revisions of "CPD-8973"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...") |
(Created page with "Category:metabolite == Metabolite 3-Hydroxy-octanoyl-ACPs == * common-name: ** a (3r)-3-hydroxyoctanoyl-[acp] == Reaction(s) known to consume the compound == * 4.2.1.59-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Hydroxy-octanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (3r)-3-hydroxyoctanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4.2.1.59-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9524]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxyoctanoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 14:53, 5 January 2021
Contents
Metabolite 3-Hydroxy-octanoyl-ACPs
- common-name:
- a (3r)-3-hydroxyoctanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyoctanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
