Difference between revisions of "CPD-8978"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-341 == * common-name: ** indole-3-ethanol * smiles: ** c2(=c(cco)c1(c=cc=cc=1n2)) * inchi-key: ** mbbomcvgycrmea-uhfffaoysa-n * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-8978 == * common-name: ** ethylphosphate * smiles: ** ccop([o-])(=o)[o-] * inchi-key: ** zjxzsiysnxkhea-uhfffaoysa-l * molecular-weig...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8978 == |
* common-name: | * common-name: | ||
− | ** | + | ** ethylphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** ccop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zjxzsiysnxkhea-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 124.033 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8748]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ethylphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zjxzsiysnxkhea-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=124.033}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8978
- common-name:
- ethylphosphate
- smiles:
- ccop([o-])(=o)[o-]
- inchi-key:
- zjxzsiysnxkhea-uhfffaoysa-l
- molecular-weight:
- 124.033