Difference between revisions of "CPD-8990"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINOLINATE == * common-name: ** quinolinate * smiles: ** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o) * inchi-key: ** gjawhxhkyyxbsv-uhfffaoysa-l...") |
(Created page with "Category:metabolite == Metabolite CPD-8990 == * common-name: ** l-methionine-(r)-s-oxide * smiles: ** cs(=o)ccc([n+])c(=o)[o-] * inchi-key: ** qefrnwwlzkmpfj-zxpfjrlxsa-n...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8990 == |
* common-name: | * common-name: | ||
− | ** | + | ** l-methionine-(r)-s-oxide |
* smiles: | * smiles: | ||
− | ** | + | ** cs(=o)ccc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qefrnwwlzkmpfj-zxpfjrlxsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** 165. | + | ** 165.207 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.8.4.14-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-methionine-(r)-s-oxide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qefrnwwlzkmpfj-zxpfjrlxsa-n}} |
− | {{#set: molecular-weight=165. | + | {{#set: molecular-weight=165.207}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-8990
- common-name:
- l-methionine-(r)-s-oxide
- smiles:
- cs(=o)ccc([n+])c(=o)[o-]
- inchi-key:
- qefrnwwlzkmpfj-zxpfjrlxsa-n
- molecular-weight:
- 165.207