Difference between revisions of "CPD-8999"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-CANALINE == * common-name: ** l-canaline * smiles: ** c(cc([n+])c(=o)[o-])on * inchi-key: ** fqpgmqabjnqllf-vkhmyheasa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8999 == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate |
* smiles: | * smiles: | ||
− | ** c( | + | ** csccc(=o)c(=o)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hkeaovfnwrdvaj-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 240.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[R145-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=240.167}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8999
- common-name:
- 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
- smiles:
- csccc(=o)c(=o)cop([o-])(=o)[o-]
- inchi-key:
- hkeaovfnwrdvaj-uhfffaoysa-l
- molecular-weight:
- 240.167