Difference between revisions of "CPD-8999"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16191 == * transcription-direction: ** negative * right-end-position: ** 85772 * left-end-position: ** 78898 * centisome-position: ** 27.566376...")
 
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16191 ==
+
== Metabolite CPD-8999 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 85772
+
** csccc(=o)c(=o)cop([o-])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 78898
+
** hkeaovfnwrdvaj-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 27.566376   
+
** 240.167
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[R145-RXN]]
−
* [[1.8.5.1-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}}
−
* [[GSHTRAN-RXN]]
+
{{#set: molecular-weight=240.167}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[GST-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13673]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15680]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6370]]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-2261]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6842]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4061]]
 
−
** '''4''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7112]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7533]]
 
−
** '''3''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=85772}}
 
−
{{#set: left-end-position=78898}}
 
−
{{#set: centisome-position=27.566376    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8999

  • common-name:
    • 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
  • smiles:
    • csccc(=o)c(=o)cop([o-])(=o)[o-]
  • inchi-key:
    • hkeaovfnwrdvaj-uhfffaoysa-l
  • molecular-weight:
    • 240.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8999&oldid=137283"