Difference between revisions of "CPD-9038"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14756 == * common-name: ** methylthiobenzoate * smiles: ** csc(c1(c=cc=cc=1))=o * inchi-key: ** rqvwtmcuthkgcm-uhfffaoysa-n * molecul...")
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14756 ==
+
== Metabolite CPD-9038 ==
 
* common-name:
 
* common-name:
** methylthiobenzoate
+
** precorrin-1
 
* smiles:
 
* smiles:
** csc(c1(c=cc=cc=1))=o
+
** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
 
* inchi-key:
 
* inchi-key:
** rqvwtmcuthkgcm-uhfffaoysa-n
+
** cjlvuwulfkhgfb-nzcajupmsa-f
 
* molecular-weight:
 
* molecular-weight:
** 152.211
+
** 842.768
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8675]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13725]]
+
* [[UROPORIIIMETHYLTRANSA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylthiobenzoate}}
+
{{#set: common-name=precorrin-1}}
{{#set: inchi-key=inchikey=rqvwtmcuthkgcm-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}}
{{#set: molecular-weight=152.211}}
+
{{#set: molecular-weight=842.768}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9038

  • common-name:
    • precorrin-1
  • smiles:
    • cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
  • inchi-key:
    • cjlvuwulfkhgfb-nzcajupmsa-f
  • molecular-weight:
    • 842.768

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality