Difference between revisions of "CPD-9066"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * smiles: ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...")
(Created page with "Category:metabolite == Metabolite CPD-9066 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-ACETO-ACETYL-COA ==
+
== Metabolite CPD-9066 ==
 +
* smiles:
 +
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** 2-methylacetoacetyl-coa
+
** bacteriochlorophyllide a
* smiles:
 
** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
 
* inchi-key:
 
** nhnodhrscralbf-nqnbqjknsa-j
 
 
* molecular-weight:
 
* molecular-weight:
** 861.604
+
** 630.982
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.178-RXN]]
+
* [[RXN-8788]]
* [[ACCAT]]
 
* [[HMNOS]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.178-RXN]]
 
* [[HMNOS]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylacetoacetyl-coa}}
+
{{#set: common-name=bacteriochlorophyllide a}}
{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}
+
{{#set: molecular-weight=630.982}}
{{#set: molecular-weight=861.604}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-9066

  • smiles:
    • ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • bacteriochlorophyllide a
  • molecular-weight:
    • 630.982

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality