Difference between revisions of "CPD-9067"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCDHm SUCDHm] == * direction: ** left-to-right * common-name: ** succinate dehydrogenase complex i...") |
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide |
| − | == | + | * smiles: |
| − | + | ** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) | |
| − | == | + | * inchi-key: |
| − | * | + | ** vdxlundmvkskho-xvfcmesisa-l |
| − | * | + | * molecular-weight: |
| − | * | + | ** 312.172 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[FGAMSYN-RXN]] | |
| − | * | + | * [[FGFTh]] |
| − | == | + | * [[FPGFTh]] |
| − | {{#set: | + | * [[GART-RXN]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[FPGFTh]] | |
| − | + | * [[GART-RXN]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}} | |
| − | + | {{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}} | |
| − | + | {{#set: molecular-weight=312.172}} | |
Revision as of 20:35, 18 December 2020
Contents
Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE
- common-name:
- n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
- smiles:
- c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- vdxlundmvkskho-xvfcmesisa-l
- molecular-weight:
- 312.172
