Difference between revisions of "CPD-9067"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...")
(Created page with "Category:metabolite == Metabolite Charged-VAL-tRNAs == * common-name: ** an l-valyl-[trnaval] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE ==
+
== Metabolite Charged-VAL-tRNAs ==
 
* common-name:
 
* common-name:
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
+
** an l-valyl-[trnaval]
* smiles:
 
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
** vdxlundmvkskho-xvfcmesisa-l
 
* molecular-weight:
 
** 312.172
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FGAMSYN-RXN]]
 
* [[FGFTh]]
 
* [[FPGFTh]]
 
* [[GART-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FPGFTh]]
+
* [[VALINE--TRNA-LIGASE-RXN]]
* [[GART-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=an l-valyl-[trnaval]}}
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}
 
{{#set: molecular-weight=312.172}}
 

Revision as of 14:57, 5 January 2021

Metabolite Charged-VAL-tRNAs

  • common-name:
    • an l-valyl-[trnaval]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-valyl-[trnaval" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.