Difference between revisions of "CPD-9088"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...")
(Created page with "Category:metabolite == Metabolite CPD-9088 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LL-DIAMINOPIMELATE ==
+
== Metabolite CPD-9088 ==
 +
* smiles:
 +
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** l,l-diaminopimelate
+
** geranylgeranyl bacteriochlorophyllide a
* smiles:
 
** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
 
* inchi-key:
 
** gmkmezvlhjarhf-whfbiakzsa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 190.199
+
** 904.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIAMINOPIMEPIM-RXN]]
+
* [[RXN-17426]]
* [[RXN-7737]]
+
* [[RXN-8789]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMEPIM-RXN]]
+
* [[RXN-8788]]
* [[RXN-7737]]
+
* [[RXN-8789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l,l-diaminopimelate}}
+
{{#set: common-name=geranylgeranyl bacteriochlorophyllide a}}
{{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}}
+
{{#set: molecular-weight=904.462}}
{{#set: molecular-weight=190.199}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-9088

  • smiles:
    • ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • geranylgeranyl bacteriochlorophyllide a
  • molecular-weight:
    • 904.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality