Difference between revisions of "CPD-9090"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o * inchi-key: ** gactwzzmvmukng...") |
(Created page with "Category:metabolite == Metabolite Reduced-2Fe-2S-Ferredoxins == * common-name: ** a reduced [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == * 2.8.1.6...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Reduced-2Fe-2S-Ferredoxins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a reduced [2fe-2s] ferredoxin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| − | * [[ | + | * [[RXN-11586]] |
| + | * [[RXN-14950]] | ||
| + | * [[RXN-14957]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-17472]] | ||
| + | * [[RXN0-949]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a reduced [2fe-2s] ferredoxin}} |
| − | |||
| − | |||
Revision as of 11:13, 15 January 2021
Contents
Metabolite Reduced-2Fe-2S-Ferredoxins
- common-name:
- a reduced [2fe-2s] ferredoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a reduced [2fe-2s] ferredoxin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
